C20H25F2NO2 — CID 112538891
2-(3,4-difluorophenyl)-3-(3-ethoxy-4-propoxyphenyl)propan-1-amine (PubChem CID 112538891) has the molecular formula C20H25F2NO2 and a molecular weight of 349.42 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-(3-ethoxy-4-propoxyphenyl)propan-1-amine.
| Compound Name | 2-(3,4-difluorophenyl)-3-(3-ethoxy-4-propoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 112538891 |
| Molecular Formula | C20H25F2NO2 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-(3-ethoxy-4-propoxyphenyl)propan-1-amine |
| SMILES | CCCOc1ccc(CC(CN)c2ccc(F)c(F)c2)cc1OCC |
| InChI | InChI=1S/C20H25F2NO2/c1-3-9-25-19-8-5-14(11-20(19)24-4-2)10-16(13-23)15-6-7-17(21)18(22)12-15/h5-8,11-12,16H,3-4,9-10,13,23H2,1-2H3 |
| InChIKey | VOYZJSILGMTQLN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |