C22H31NO2 — CID 83972845
2-(2,4-dimethylphenyl)-3-(3-ethoxy-4-propoxyphenyl)propan-1-amine (PubChem CID 83972845) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-3-(3-ethoxy-4-propoxyphenyl)propan-1-amine.
| Compound Name | 2-(2,4-dimethylphenyl)-3-(3-ethoxy-4-propoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83972845 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-3-(3-ethoxy-4-propoxyphenyl)propan-1-amine |
| SMILES | CCCOc1ccc(CC(CN)c2ccc(C)cc2C)cc1OCC |
| InChI | InChI=1S/C22H31NO2/c1-5-11-25-21-10-8-18(14-22(21)24-6-2)13-19(15-23)20-9-7-16(3)12-17(20)4/h7-10,12,14,19H,5-6,11,13,15,23H2,1-4H3 |
| InChIKey | SIMZRCMBYAULPE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |