C22H31NO2 — CID 83972849
3-(3-butoxy-4-methoxyphenyl)-2-(2,4-dimethylphenyl)propan-1-amine (PubChem CID 83972849) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 3-(3-butoxy-4-methoxyphenyl)-2-(2,4-dimethylphenyl)propan-1-amine.
| Compound Name | 3-(3-butoxy-4-methoxyphenyl)-2-(2,4-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83972849 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 3-(3-butoxy-4-methoxyphenyl)-2-(2,4-dimethylphenyl)propan-1-amine |
| SMILES | CCCCOc1cc(CC(CN)c2ccc(C)cc2C)ccc1OC |
| InChI | InChI=1S/C22H31NO2/c1-5-6-11-25-22-14-18(8-10-21(22)24-4)13-19(15-23)20-9-7-16(2)12-17(20)3/h7-10,12,14,19H,5-6,11,13,15,23H2,1-4H3 |
| InChIKey | BQHYHIKBPUKKSX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|