C19H28N2O2S — CID 112539221
3-(3-butoxy-4-methoxyphenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-1-amine (PubChem CID 112539221) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 3-(3-butoxy-4-methoxyphenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-1-amine.
| Compound Name | 3-(3-butoxy-4-methoxyphenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 112539221 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 3-(3-butoxy-4-methoxyphenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-1-amine |
| SMILES | CCCCOc1cc(CC(CN)c2nc(C)c(C)s2)ccc1OC |
| InChI | InChI=1S/C19H28N2O2S/c1-5-6-9-23-18-11-15(7-8-17(18)22-4)10-16(12-20)19-21-13(2)14(3)24-19/h7-8,11,16H,5-6,9-10,12,20H2,1-4H3 |
| InChIKey | QNCKHPXOABUNGU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|