C17H28O4 — CID 83932064
5-(3,4-dipropoxyphenyl)pentane-2,3-diol (PubChem CID 83932064) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 5-(3,4-dipropoxyphenyl)pentane-2,3-diol.
| Compound Name | 5-(3,4-dipropoxyphenyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 83932064 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 5-(3,4-dipropoxyphenyl)pentane-2,3-diol |
| SMILES | CCCOc1ccc(CCC(O)C(C)O)cc1OCCC |
| InChI | InChI=1S/C17H28O4/c1-4-10-20-16-9-7-14(6-8-15(19)13(3)18)12-17(16)21-11-5-2/h7,9,12-13,15,18-19H,4-6,8,10-11H2,1-3H3 |
| InChIKey | MYQLQGRKAIMCST-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |