C15H21F3O3 — CID 83921363
5-[2-propoxy-5-(trifluoromethyl)phenyl]pentane-2,3-diol (PubChem CID 83921363) has the molecular formula C15H21F3O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 5-[2-propoxy-5-(trifluoromethyl)phenyl]pentane-2,3-diol.
| Compound Name | 5-[2-propoxy-5-(trifluoromethyl)phenyl]pentane-2,3-diol |
|---|---|
| PubChem CID | 83921363 |
| Molecular Formula | C15H21F3O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 5-[2-propoxy-5-(trifluoromethyl)phenyl]pentane-2,3-diol |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1CCC(O)C(C)O |
| InChI | InChI=1S/C15H21F3O3/c1-3-8-21-14-7-5-12(15(16,17)18)9-11(14)4-6-13(20)10(2)19/h5,7,9-10,13,19-20H,3-4,6,8H2,1-2H3 |
| InChIKey | IPAHBQPVVVKNFM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |