C13H17F3OS — CID 83921271
3-[2-propoxy-5-(trifluoromethyl)phenyl]propane-1-thiol (PubChem CID 83921271) has the molecular formula C13H17F3OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 3-[2-propoxy-5-(trifluoromethyl)phenyl]propane-1-thiol.
| Compound Name | 3-[2-propoxy-5-(trifluoromethyl)phenyl]propane-1-thiol |
|---|---|
| PubChem CID | 83921271 |
| Molecular Formula | C13H17F3OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-[2-propoxy-5-(trifluoromethyl)phenyl]propane-1-thiol |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1CCCS |
| InChI | InChI=1S/C13H17F3OS/c1-2-7-17-12-6-5-11(13(14,15)16)9-10(12)4-3-8-18/h5-6,9,18H,2-4,7-8H2,1H3 |
| InChIKey | LYTHJKNWPNJXHM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|