C47H72O3S6 — CID 118327247
3-[5-[1,1-bis[4-propoxy-3,5-bis(3-sulfanylpropyl)phenyl]ethyl]-2-propoxy-3-(3-sulfanylpropyl)phenyl]propane-1-thiol (PubChem CID 118327247) has the molecular formula C47H72O3S6 and a molecular weight of 877.49 g/mol. Its IUPAC name is 3-[5-[1,1-bis[4-propoxy-3,5-bis(3-sulfanylpropyl)phenyl]ethyl]-2-propoxy-3-(3-sulfanylpropyl)phenyl]propane-1-thiol.
| Compound Name | 3-[5-[1,1-bis[4-propoxy-3,5-bis(3-sulfanylpropyl)phenyl]ethyl]-2-propoxy-3-(3-sulfanylpropyl)phenyl]propane-1-thiol |
|---|---|
| PubChem CID | 118327247 |
| Molecular Formula | C47H72O3S6 |
| Molecular Weight | 877.49 g/mol |
| Exact Mass | 876.38 |
| IUPAC Name | 3-[5-[1,1-bis[4-propoxy-3,5-bis(3-sulfanylpropyl)phenyl]ethyl]-2-propoxy-3-(3-sulfanylpropyl)phenyl]propane-1-thiol |
| SMILES | CCCOc1c(CCCS)cc(C(C)(c2cc(CCCS)c(OCCC)c(CCCS)c2)c2cc(CCCS)c(OCCC)c(CCCS)c2)cc1CCCS |
| InChI | InChI=1S/C47H72O3S6/c1-5-20-48-44-35(14-8-23-51)29-41(30-36(44)15-9-24-52)47(4,42-31-37(16-10-25-53)45(49-21-6-2)38(32-42)17-11-26-54)43-33-39(18-12-27-55)46(50-22-7-3)40(34-43)19-13-28-56/h29-34,51-56H,5-28H2,1-4H3 |
| InChIKey | SNFBTAVGQXGMLD-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.49 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|