C21H36O5 — CID 91365553
1,2,3,4,5-pentapropoxybenzene (PubChem CID 91365553) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is 1,2,3,4,5-pentapropoxybenzene.
| Compound Name | 1,2,3,4,5-pentapropoxybenzene |
|---|---|
| PubChem CID | 91365553 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 1,2,3,4,5-pentapropoxybenzene |
| SMILES | CCCOc1cc(OCCC)c(OCCC)c(OCCC)c1OCCC |
| InChI | InChI=1S/C21H36O5/c1-6-11-22-17-16-18(23-12-7-2)20(25-14-9-4)21(26-15-10-5)19(17)24-13-8-3/h16H,6-15H2,1-5H3 |
| InChIKey | ZLOJHYXDTDTVRI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |