C17H26O3 — CID 102253106
5-ethenyl-1,2,3-tripropoxybenzene (PubChem CID 102253106) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 5-ethenyl-1,2,3-tripropoxybenzene.
| Compound Name | 5-ethenyl-1,2,3-tripropoxybenzene |
|---|---|
| PubChem CID | 102253106 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 5-ethenyl-1,2,3-tripropoxybenzene |
| SMILES | C=Cc1cc(OCCC)c(OCCC)c(OCCC)c1 |
| InChI | InChI=1S/C17H26O3/c1-5-9-18-15-12-14(8-4)13-16(19-10-6-2)17(15)20-11-7-3/h8,12-13H,4-7,9-11H2,1-3H3 |
| InChIKey | DWAUFSOBAINYOQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |