C22H26O5 — CID 11291660
5-ethenyl-2-[2-[2-(4-ethenylphenoxy)ethoxy]ethoxy]-1,3-dimethoxybenzene (PubChem CID 11291660) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-ethenyl-2-[2-[2-(4-ethenylphenoxy)ethoxy]ethoxy]-1,3-dimethoxybenzene.
| Compound Name | 5-ethenyl-2-[2-[2-(4-ethenylphenoxy)ethoxy]ethoxy]-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 11291660 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 5-ethenyl-2-[2-[2-(4-ethenylphenoxy)ethoxy]ethoxy]-1,3-dimethoxybenzene |
| SMILES | C=Cc1ccc(OCCOCCOc2c(OC)cc(C=C)cc2OC)cc1 |
| InChI | InChI=1S/C22H26O5/c1-5-17-7-9-19(10-8-17)26-13-11-25-12-14-27-22-20(23-3)15-18(6-2)16-21(22)24-4/h5-10,15-16H,1-2,11-14H2,3-4H3 |
| InChIKey | UYEORVBHKQLNAC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|