C45H48O9 — CID 101241256
[3,5-bis[2-[2-[4-[(4-ethenylphenyl)methoxy]phenoxy]ethoxy]ethoxy]phenyl]methanol (PubChem CID 101241256) has the molecular formula C45H48O9 and a molecular weight of 732.87 g/mol. Its IUPAC name is [3,5-bis[2-[2-[4-[(4-ethenylphenyl)methoxy]phenoxy]ethoxy]ethoxy]phenyl]methanol.
| Compound Name | [3,5-bis[2-[2-[4-[(4-ethenylphenyl)methoxy]phenoxy]ethoxy]ethoxy]phenyl]methanol |
|---|---|
| PubChem CID | 101241256 |
| Molecular Formula | C45H48O9 |
| Molecular Weight | 732.87 g/mol |
| Exact Mass | 732.33 |
| IUPAC Name | [3,5-bis[2-[2-[4-[(4-ethenylphenyl)methoxy]phenoxy]ethoxy]ethoxy]phenyl]methanol |
| SMILES | C=Cc1ccc(COc2ccc(OCCOCCOc3cc(CO)cc(OCCOCCOc4ccc(OCc5ccc(C=C)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C45H48O9/c1-3-35-5-9-37(10-6-35)33-53-42-17-13-40(14-18-42)49-25-21-47-23-27-51-44-29-39(32-46)30-45(31-44)52-28-24-48-22-26-50-41-15-19-43(20-16-41)54-34-38-11-7-36(4-2)8-12-38/h3-20,29-31,46H,1-2,21-28,32-34H2 |
| InChIKey | IDGDJYPOVWSNBU-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.87 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|