C81H108O31 — CID 10796614
[3,5-bis[[3,5-bis[[3,5-bis(2-methoxyethoxymethoxy)phenyl]methoxy]phenyl]methoxy]phenyl]methanol (PubChem CID 10796614) has the molecular formula C81H108O31 and a molecular weight of 1577.72 g/mol. Its IUPAC name is [3,5-bis[[3,5-bis[[3,5-bis(2-methoxyethoxymethoxy)phenyl]methoxy]phenyl]methoxy]phenyl]methanol.
| Compound Name | [3,5-bis[[3,5-bis[[3,5-bis(2-methoxyethoxymethoxy)phenyl]methoxy]phenyl]methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 10796614 |
| Molecular Formula | C81H108O31 |
| Molecular Weight | 1577.72 g/mol |
| Exact Mass | 1576.69 |
| IUPAC Name | [3,5-bis[[3,5-bis[[3,5-bis(2-methoxyethoxymethoxy)phenyl]methoxy]phenyl]methoxy]phenyl]methanol |
| SMILES | COCCOCOc1cc(COc2cc(COc3cc(CO)cc(OCc4cc(OCc5cc(OCOCCOC)cc(OCOCCOC)c5)cc(OCc5cc(OCOCCOC)cc(OCOCCOC)c5)c4)c3)cc(OCc3cc(OCOCCOC)cc(OCOCCOC)c3)c2)cc(OCOCCOC)c1 |
| InChI | InChI=1S/C81H108O31/c1-83-9-17-91-53-105-74-31-64(32-75(42-74)106-54-92-18-10-84-2)49-101-70-27-62(28-71(40-70)102-50-65-33-76(107-55-93-19-11-85-3)43-77(34-65)108-56-94-20-12-86-4)47-99-68-25-61(46-82)26-69(39-68)100-48-63-29-72(103-51-66-35-78(109-57-95-21-13-87-5)44-79(36-66)110-58-96-22-14-88-6)41-73(30-63)104-52-67-37-80(111-59-97-23-15-89-7)45-81(38-67)112-60-98-24-16-90-8/h25-45,82H,9-24,46-60H2,1-8H3 |
| InChIKey | NFBVNYDLBJQEEK-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 297.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 31 |
| Rotatable Bonds | 67 |
| Heavy Atoms | 112 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1577.72 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 31 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|