C57H60O15 — CID 101100720
[3,5-bis[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methoxy]phenyl]methanol (PubChem CID 101100720) has the molecular formula C57H60O15 and a molecular weight of 985.09 g/mol. Its IUPAC name is [3,5-bis[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methoxy]phenyl]methanol.
| Compound Name | [3,5-bis[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 101100720 |
| Molecular Formula | C57H60O15 |
| Molecular Weight | 985.09 g/mol |
| Exact Mass | 984.39 |
| IUPAC Name | [3,5-bis[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methoxy]phenyl]methanol |
| SMILES | COc1cc(COc2cc(COc3cc(CO)cc(OCc4cc(OCc5cc(OC)cc(OC)c5)cc(OCc5cc(OC)cc(OC)c5)c4)c3)cc(OCc3cc(OC)cc(OC)c3)c2)cc(OC)c1 |
| InChI | InChI=1S/C57H60O15/c1-59-44-11-38(12-45(23-44)60-2)31-69-54-19-42(20-55(28-54)70-32-39-13-46(61-3)24-47(14-39)62-4)35-67-52-9-37(30-58)10-53(27-52)68-36-43-21-56(71-33-40-15-48(63-5)25-49(16-40)64-6)29-57(22-43)72-34-41-17-50(65-7)26-51(18-41)66-8/h9-29,58H,30-36H2,1-8H3 |
| InChIKey | HSCYCAHCUAZNMR-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 149.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.09 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |