C81H93N3O18 — CID 100958899
1,4,7-tris[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methyl]-1,4,7-triazonane (PubChem CID 100958899) has the molecular formula C81H93N3O18 and a molecular weight of 1396.64 g/mol. Its IUPAC name is 1,4,7-tris[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methyl]-1,4,7-triazonane.
| Compound Name | 1,4,7-tris[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methyl]-1,4,7-triazonane |
|---|---|
| PubChem CID | 100958899 |
| Molecular Formula | C81H93N3O18 |
| Molecular Weight | 1396.64 g/mol |
| Exact Mass | 1395.65 |
| IUPAC Name | 1,4,7-tris[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methyl]-1,4,7-triazonane |
| SMILES | COc1cc(COc2cc(CN3CCN(Cc4cc(OCc5cc(OC)cc(OC)c5)cc(OCc5cc(OC)cc(OC)c5)c4)CCN(Cc4cc(OCc5cc(OC)cc(OC)c5)cc(OCc5cc(OC)cc(OC)c5)c4)CC3)cc(OCc3cc(OC)cc(OC)c3)c2)cc(OC)c1 |
| InChI | InChI=1S/C81H93N3O18/c1-85-64-25-58(26-65(37-64)86-2)49-97-76-19-55(20-77(43-76)98-50-59-27-66(87-3)38-67(28-59)88-4)46-82-13-15-83(47-56-21-78(99-51-60-29-68(89-5)39-69(30-60)90-6)44-79(22-56)100-52-61-31-70(91-7)40-71(32-61)92-8)17-18-84(16-14-82)48-57-23-80(101-53-62-33-72(93-9)41-73(34-62)94-10)45-81(24-57)102-54-63-35-74(95-11)42-75(36-63)96-12/h19-45H,13-18,46-54H2,1-12H3 |
| InChIKey | NKJMQLGWMGSCDS-UHFFFAOYSA-N |
| XLogP | 14.08 |
| TPSA | 175.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 102 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1396.64 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |