C28H30O7 — CID 101386710
1,3-bis[(3,5-dimethoxyphenyl)methoxy]-5-(prop-2-ynoxymethyl)benzene (PubChem CID 101386710) has the molecular formula C28H30O7 and a molecular weight of 478.54 g/mol. Its IUPAC name is 1,3-bis[(3,5-dimethoxyphenyl)methoxy]-5-(prop-2-ynoxymethyl)benzene.
| Compound Name | 1,3-bis[(3,5-dimethoxyphenyl)methoxy]-5-(prop-2-ynoxymethyl)benzene |
|---|---|
| PubChem CID | 101386710 |
| Molecular Formula | C28H30O7 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 1,3-bis[(3,5-dimethoxyphenyl)methoxy]-5-(prop-2-ynoxymethyl)benzene |
| SMILES | C#CCOCc1cc(OCc2cc(OC)cc(OC)c2)cc(OCc2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C28H30O7/c1-6-7-33-17-20-12-27(34-18-21-8-23(29-2)14-24(9-21)30-3)16-28(13-20)35-19-22-10-25(31-4)15-26(11-22)32-5/h1,8-16H,7,17-19H2,2-5H3 |
| InChIKey | CCXZFTZHIZEYLL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|