C12H12Br2O — CID 162774528
1,3-bis(bromomethyl)-5-(prop-2-ynoxymethyl)benzene (PubChem CID 162774528) has the molecular formula C12H12Br2O and a molecular weight of 332.04 g/mol. Its IUPAC name is 1,3-bis(bromomethyl)-5-(prop-2-ynoxymethyl)benzene.
| Compound Name | 1,3-bis(bromomethyl)-5-(prop-2-ynoxymethyl)benzene |
|---|---|
| PubChem CID | 162774528 |
| Molecular Formula | C12H12Br2O |
| Molecular Weight | 332.04 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 1,3-bis(bromomethyl)-5-(prop-2-ynoxymethyl)benzene |
| SMILES | C#CCOCc1cc(CBr)cc(CBr)c1 |
| InChI | InChI=1S/C12H12Br2O/c1-2-3-15-9-12-5-10(7-13)4-11(6-12)8-14/h1,4-6H,3,7-9H2 |
| InChIKey | BGIFKCGQWUMDCA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.04 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|