C9H12O4 — CID 89188233
1-(hydroperoxymethyl)-3,5-dimethoxybenzene (PubChem CID 89188233) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-(hydroperoxymethyl)-3,5-dimethoxybenzene.
| Compound Name | 1-(hydroperoxymethyl)-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 89188233 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-(hydroperoxymethyl)-3,5-dimethoxybenzene |
| SMILES | COc1cc(COO)cc(OC)c1 |
| InChI | InChI=1S/C9H12O4/c1-11-8-3-7(6-13-10)4-9(5-8)12-2/h3-5,10H,6H2,1-2H3 |
| InChIKey | IDJBUIIWFWGCDR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|