C13H20O5 — CID 135039830
2-[(3,5-dimethoxyphenyl)methoxy]-2-methylpropane-1,3-diol (PubChem CID 135039830) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyphenyl)methoxy]-2-methylpropane-1,3-diol.
| Compound Name | 2-[(3,5-dimethoxyphenyl)methoxy]-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 135039830 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-[(3,5-dimethoxyphenyl)methoxy]-2-methylpropane-1,3-diol |
| SMILES | COc1cc(COC(C)(CO)CO)cc(OC)c1 |
| InChI | InChI=1S/C13H20O5/c1-13(8-14,9-15)18-7-10-4-11(16-2)6-12(5-10)17-3/h4-6,14-15H,7-9H2,1-3H3 |
| InChIKey | XDKUJHPOQRUZCR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |