C24H26O7 — CID 54586280
3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenol (PubChem CID 54586280) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenol.
| Compound Name | 3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenol |
|---|---|
| PubChem CID | 54586280 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenol |
| SMILES | COc1cc(COc2cc(O)cc(OCc3cc(OC)cc(OC)c3)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H26O7/c1-26-19-5-16(6-20(11-19)27-2)14-30-23-9-18(25)10-24(13-23)31-15-17-7-21(28-3)12-22(8-17)29-4/h5-13,25H,14-15H2,1-4H3 |
| InChIKey | NRSVRCTVJJHSFW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |