C58H59NO14Se — CID 15891041
[3,5-bis[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methoxy]phenyl]methyl selenocyanate (PubChem CID 15891041) has the molecular formula C58H59NO14Se and a molecular weight of 1073.06 g/mol. Its IUPAC name is [3,5-bis[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methoxy]phenyl]methyl selenocyanate.
| Compound Name | [3,5-bis[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methoxy]phenyl]methyl selenocyanate |
|---|---|
| PubChem CID | 15891041 |
| Molecular Formula | C58H59NO14Se |
| Molecular Weight | 1073.06 g/mol |
| Exact Mass | 1073.31 |
| IUPAC Name | [3,5-bis[[3,5-bis[(3,5-dimethoxyphenyl)methoxy]phenyl]methoxy]phenyl]methyl selenocyanate |
| SMILES | COc1cc(COc2cc(COc3cc(C[Se]C#N)cc(OCc4cc(OCc5cc(OC)cc(OC)c5)cc(OCc5cc(OC)cc(OC)c5)c4)c3)cc(OCc3cc(OC)cc(OC)c3)c2)cc(OC)c1 |
| InChI | InChI=1S/C58H59NO14Se/c1-60-45-9-38(10-46(23-45)61-2)30-68-53-17-42(18-54(27-53)69-31-39-11-47(62-3)24-48(12-39)63-4)34-72-57-21-44(36-74-37-59)22-58(29-57)73-35-43-19-55(70-32-40-13-49(64-5)25-50(14-40)65-6)28-56(20-43)71-33-41-15-51(66-7)26-52(16-41)67-8/h9-29H,30-36H2,1-8H3 |
| InChIKey | GHUKEMJBYWXFHS-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 153.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.06 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|