C11H14O4S — CID 18339235
(3,5-dimethoxyphenyl)methyl methylsulfanylformate (PubChem CID 18339235) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)methyl methylsulfanylformate.
| Compound Name | (3,5-dimethoxyphenyl)methyl methylsulfanylformate |
|---|---|
| PubChem CID | 18339235 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (3,5-dimethoxyphenyl)methyl methylsulfanylformate |
| SMILES | COc1cc(COC(=O)SC)cc(OC)c1 |
| InChI | InChI=1S/C11H14O4S/c1-13-9-4-8(5-10(6-9)14-2)7-15-11(12)16-3/h4-6H,7H2,1-3H3 |
| InChIKey | LAAOKGZULOXORW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|