C9H15O3P — CID 175232895
phosphane;1,3,5-trimethoxybenzene (PubChem CID 175232895) has the molecular formula C9H15O3P and a molecular weight of 202.19 g/mol. Its IUPAC name is phosphane;1,3,5-trimethoxybenzene.
| Compound Name | phosphane;1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 175232895 |
| Molecular Formula | C9H15O3P |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | phosphane;1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)cc(OC)c1.P |
| InChI | InChI=1S/C9H12O3.H3P/c1-10-7-4-8(11-2)6-9(5-7)12-3;/h4-6H,1-3H3;1H3 |
| InChIKey | HDKJMRDXFOABSR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|