C18H22O5 — CID 126607837
1-[(3,5-dimethoxyphenyl)-methoxymethyl]-3,5-dimethoxybenzene (PubChem CID 126607837) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)-methoxymethyl]-3,5-dimethoxybenzene.
| Compound Name | 1-[(3,5-dimethoxyphenyl)-methoxymethyl]-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 126607837 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)-methoxymethyl]-3,5-dimethoxybenzene |
| SMILES | COc1cc(OC)cc(C(OC)c2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C18H22O5/c1-19-14-6-12(7-15(10-14)20-2)18(23-5)13-8-16(21-3)11-17(9-13)22-4/h6-11,18H,1-5H3 |
| InChIKey | DKKVJWABFPLBAR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |