C8H11O2P — CID 23215298
(3,5-dimethoxyphenyl)phosphane (PubChem CID 23215298) has the molecular formula C8H11O2P and a molecular weight of 170.15 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)phosphane.
| Compound Name | (3,5-dimethoxyphenyl)phosphane |
|---|---|
| PubChem CID | 23215298 |
| Molecular Formula | C8H11O2P |
| Molecular Weight | 170.15 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | (3,5-dimethoxyphenyl)phosphane |
| SMILES | COc1cc(P)cc(OC)c1 |
| InChI | InChI=1S/C8H11O2P/c1-9-6-3-7(10-2)5-8(11)4-6/h3-5H,11H2,1-2H3 |
| InChIKey | UPQVIZZKMYHCHR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|