C10H16O2 — CID 142906999
1,3-dimethoxy-5-methylbenzene;methane (PubChem CID 142906999) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1,3-dimethoxy-5-methylbenzene;methane.
| Compound Name | 1,3-dimethoxy-5-methylbenzene;methane |
|---|---|
| PubChem CID | 142906999 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1,3-dimethoxy-5-methylbenzene;methane |
| SMILES | C.COc1cc(C)cc(OC)c1 |
| InChI | InChI=1S/C9H12O2.CH4/c1-7-4-8(10-2)6-9(5-7)11-3;/h4-6H,1-3H3;1H4 |
| InChIKey | CLWNHJJWSCKEEE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |