C9H14OS — CID 175727345
1-methoxy-3,5-dimethylbenzene;sulfane (PubChem CID 175727345) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is 1-methoxy-3,5-dimethylbenzene;sulfane.
| Compound Name | 1-methoxy-3,5-dimethylbenzene;sulfane |
|---|---|
| PubChem CID | 175727345 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1-methoxy-3,5-dimethylbenzene;sulfane |
| SMILES | COc1cc(C)cc(C)c1.S |
| InChI | InChI=1S/C9H12O.H2S/c1-7-4-8(2)6-9(5-7)10-3;/h4-6H,1-3H3;1H2 |
| InChIKey | DLRMODHJWJTETQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |