C9H12Cl2O3S — CID 87072267
1-methoxy-3,5-dimethylbenzene;sulfuryl dichloride (PubChem CID 87072267) has the molecular formula C9H12Cl2O3S and a molecular weight of 271.17 g/mol. Its IUPAC name is 1-methoxy-3,5-dimethylbenzene;sulfuryl dichloride.
| Compound Name | 1-methoxy-3,5-dimethylbenzene;sulfuryl dichloride |
|---|---|
| PubChem CID | 87072267 |
| Molecular Formula | C9H12Cl2O3S |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 1-methoxy-3,5-dimethylbenzene;sulfuryl dichloride |
| SMILES | COc1cc(C)cc(C)c1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C9H12O.Cl2O2S/c1-7-4-8(2)6-9(5-7)10-3;1-5(2,3)4/h4-6H,1-3H3; |
| InChIKey | QULOHBIHUYUSSK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |