C8H10NNaO4S — CID 174221299
sodium N-(3-methoxy-5-methylphenyl)sulfamate (PubChem CID 174221299) has the molecular formula C8H10NNaO4S and a molecular weight of 239.23 g/mol. Its IUPAC name is sodium N-(3-methoxy-5-methylphenyl)sulfamate.
| Compound Name | sodium N-(3-methoxy-5-methylphenyl)sulfamate |
|---|---|
| PubChem CID | 174221299 |
| Molecular Formula | C8H10NNaO4S |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | sodium N-(3-methoxy-5-methylphenyl)sulfamate |
| SMILES | COc1cc(C)cc(NS(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C8H11NO4S.Na/c1-6-3-7(9-14(10,11)12)5-8(4-6)13-2;/h3-5,9H,1-2H3,(H,10,11,12);/q;+1/p-1 |
| InChIKey | JCQIXSMJAQEBGW-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|