C13H15NO4S2 — CID 18191077
N-(3,5-dimethoxyphenyl)-5-methylthiophene-2-sulfonamide (PubChem CID 18191077) has the molecular formula C13H15NO4S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 18191077 |
| Molecular Formula | C13H15NO4S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-5-methylthiophene-2-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(C)s2)cc(OC)c1 |
| InChI | InChI=1S/C13H15NO4S2/c1-9-4-5-13(19-9)20(15,16)14-10-6-11(17-2)8-12(7-10)18-3/h4-8,14H,1-3H3 |
| InChIKey | HJUZSRCPVDDTKZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |