C11H9Cl2NO2S2 — CID 18191064
N-(3,5-dichlorophenyl)-5-methylthiophene-2-sulfonamide (PubChem CID 18191064) has the molecular formula C11H9Cl2NO2S2 and a molecular weight of 322.24 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 18191064 |
| Molecular Formula | C11H9Cl2NO2S2 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | N-(3,5-dichlorophenyl)-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C11H9Cl2NO2S2/c1-7-2-3-11(17-7)18(15,16)14-10-5-8(12)4-9(13)6-10/h2-6,14H,1H3 |
| InChIKey | WDIULRRFTAJQCI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |