C13H10Cl3NO2S — CID 123943887
4-chloro-N-(3,5-dichlorophenyl)-2-methylbenzenesulfonamide (PubChem CID 123943887) has the molecular formula C13H10Cl3NO2S and a molecular weight of 350.65 g/mol. Its IUPAC name is 4-chloro-N-(3,5-dichlorophenyl)-2-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(3,5-dichlorophenyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 123943887 |
| Molecular Formula | C13H10Cl3NO2S |
| Molecular Weight | 350.65 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 4-chloro-N-(3,5-dichlorophenyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H10Cl3NO2S/c1-8-4-9(14)2-3-13(8)20(18,19)17-12-6-10(15)5-11(16)7-12/h2-7,17H,1H3 |
| InChIKey | VDLOWLXVXGTCPJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |