C13H11Cl2NO4S2 — CID 55532986
N-(3,5-dichlorophenyl)-2-methylsulfonylbenzenesulfonamide (PubChem CID 55532986) has the molecular formula C13H11Cl2NO4S2 and a molecular weight of 380.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55532986 |
| Molecular Formula | C13H11Cl2NO4S2 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO4S2/c1-21(17,18)12-4-2-3-5-13(12)22(19,20)16-11-7-9(14)6-10(15)8-11/h2-8,16H,1H3 |
| InChIKey | ORAFQLOVYLZTJX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |