C21H17ClN2O7S3 — CID 67970119
N-[5-chloro-2-[(2-methylsulfonylphenyl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide (PubChem CID 67970119) has the molecular formula C21H17ClN2O7S3 and a molecular weight of 541.03 g/mol. Its IUPAC name is N-[5-chloro-2-[(2-methylsulfonylphenyl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[5-chloro-2-[(2-methylsulfonylphenyl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 67970119 |
| Molecular Formula | C21H17ClN2O7S3 |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | N-[5-chloro-2-[(2-methylsulfonylphenyl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)Nc1ccc(Cl)cc1NS(=O)(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H17ClN2O7S3/c1-32(25,26)19-8-4-5-9-20(19)33(27,28)23-16-11-10-15(22)13-17(16)24-34(29,30)21-12-14-6-2-3-7-18(14)31-21/h2-13,23-24H,1H3 |
| InChIKey | SCDKMGGYWIAGHL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |