C21H14Cl2N2O7S2 — CID 88544142
[5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-2-chlorophenyl] formate (PubChem CID 88544142) has the molecular formula C21H14Cl2N2O7S2 and a molecular weight of 541.39 g/mol. Its IUPAC name is [5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-2-chlorophenyl] formate.
| Compound Name | [5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-2-chlorophenyl] formate |
|---|---|
| PubChem CID | 88544142 |
| Molecular Formula | C21H14Cl2N2O7S2 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 539.96 |
| IUPAC Name | [5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-2-chlorophenyl] formate |
| SMILES | O=COc1cc(S(=O)(=O)Nc2ccc(Cl)cc2NS(=O)(=O)c2cc3ccccc3o2)ccc1Cl |
| InChI | InChI=1S/C21H14Cl2N2O7S2/c22-14-5-8-17(24-33(27,28)15-6-7-16(23)20(11-15)31-12-26)18(10-14)25-34(29,30)21-9-13-3-1-2-4-19(13)32-21/h1-12,24-25H |
| InChIKey | KWSWLHMJJCTIAO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|