C16H15ClN2O5S2 — CID 67970231
N-[5-chloro-2-(ethylsulfonylamino)phenyl]-1-benzofuran-2-sulfonamide (PubChem CID 67970231) has the molecular formula C16H15ClN2O5S2 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[5-chloro-2-(ethylsulfonylamino)phenyl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[5-chloro-2-(ethylsulfonylamino)phenyl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 67970231 |
| Molecular Formula | C16H15ClN2O5S2 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | N-[5-chloro-2-(ethylsulfonylamino)phenyl]-1-benzofuran-2-sulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Cl)cc1NS(=O)(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H15ClN2O5S2/c1-2-25(20,21)18-13-8-7-12(17)10-14(13)19-26(22,23)16-9-11-5-3-4-6-15(11)24-16/h3-10,18-19H,2H2,1H3 |
| InChIKey | URCAYMWEPYEHOI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |