C26H19ClN2O6S2 — CID 67970160
N-[5-chloro-2-[(4-phenoxyphenyl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide (PubChem CID 67970160) has the molecular formula C26H19ClN2O6S2 and a molecular weight of 555.03 g/mol. Its IUPAC name is N-[5-chloro-2-[(4-phenoxyphenyl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[5-chloro-2-[(4-phenoxyphenyl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 67970160 |
| Molecular Formula | C26H19ClN2O6S2 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | N-[5-chloro-2-[(4-phenoxyphenyl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1NS(=O)(=O)c1cc2ccccc2o1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H19ClN2O6S2/c27-19-10-15-23(24(17-19)29-37(32,33)26-16-18-6-4-5-9-25(18)35-26)28-36(30,31)22-13-11-21(12-14-22)34-20-7-2-1-3-8-20/h1-17,28-29H |
| InChIKey | YGHXORPGDIGEST-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |