C28H18Cl2N2O6S4 — CID 86667125
N-[2-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]disulfanyl]-5-chlorophenyl]-1-benzofuran-2-sulfonamide (PubChem CID 86667125) has the molecular formula C28H18Cl2N2O6S4 and a molecular weight of 677.63 g/mol. Its IUPAC name is N-[2-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]disulfanyl]-5-chlorophenyl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[2-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]disulfanyl]-5-chlorophenyl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 86667125 |
| Molecular Formula | C28H18Cl2N2O6S4 |
| Molecular Weight | 677.63 g/mol |
| Exact Mass | 675.94 |
| IUPAC Name | N-[2-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]disulfanyl]-5-chlorophenyl]-1-benzofuran-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)ccc1SSc1ccc(Cl)cc1NS(=O)(=O)c1cc2ccccc2o1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C28H18Cl2N2O6S4/c29-19-9-11-25(21(15-19)31-41(33,34)27-13-17-5-1-3-7-23(17)37-27)39-40-26-12-10-20(30)16-22(26)32-42(35,36)28-14-18-6-2-4-8-24(18)38-28/h1-16,31-32H |
| InChIKey | XSFIGHCTVAONBZ-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.63 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|