C19H17ClN4O5S2 — CID 130412255
5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfanylmethyl]-N-hydroxy-N-methyl-1H-pyrazol-3-amine oxide (PubChem CID 130412255) has the molecular formula C19H17ClN4O5S2 and a molecular weight of 480.96 g/mol. Its IUPAC name is 5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfanylmethyl]-N-hydroxy-N-methyl-1H-pyrazol-3-amine oxide.
| Compound Name | 5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfanylmethyl]-N-hydroxy-N-methyl-1H-pyrazol-3-amine oxide |
|---|---|
| PubChem CID | 130412255 |
| Molecular Formula | C19H17ClN4O5S2 |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfanylmethyl]-N-hydroxy-N-methyl-1H-pyrazol-3-amine oxide |
| SMILES | C[N+]([O-])(O)c1cc(CSc2ccc(Cl)cc2NS(=O)(=O)c2cc3ccccc3o2)[nH]n1 |
| InChI | InChI=1S/C19H17ClN4O5S2/c1-24(25,26)18-10-14(21-22-18)11-30-17-7-6-13(20)9-15(17)23-31(27,28)19-8-12-4-2-3-5-16(12)29-19/h2-10,23,25H,11H2,1H3,(H,21,22) |
| InChIKey | UFYKFJARUPJNNA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|