C23H19ClN2O8S2 — CID 57382885
5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-2-ethoxybenzoic acid (PubChem CID 57382885) has the molecular formula C23H19ClN2O8S2 and a molecular weight of 551.00 g/mol. Its IUPAC name is 5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-2-ethoxybenzoic acid.
| Compound Name | 5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-2-ethoxybenzoic acid |
|---|---|
| PubChem CID | 57382885 |
| Molecular Formula | C23H19ClN2O8S2 |
| Molecular Weight | 551.00 g/mol |
| Exact Mass | 550.03 |
| IUPAC Name | 5-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-2-ethoxybenzoic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2NS(=O)(=O)c2cc3ccccc3o2)cc1C(=O)O |
| InChI | InChI=1S/C23H19ClN2O8S2/c1-2-33-21-10-8-16(13-17(21)23(27)28)35(29,30)25-18-9-7-15(24)12-19(18)26-36(31,32)22-11-14-5-3-4-6-20(14)34-22/h3-13,25-26H,2H2,1H3,(H,27,28) |
| InChIKey | ZCEOISBDNGGFCA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.00 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |