C22H16ClNO7S2 — CID 71714818
2-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfonylmethyl]benzoic acid (PubChem CID 71714818) has the molecular formula C22H16ClNO7S2 and a molecular weight of 505.96 g/mol. Its IUPAC name is 2-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfonylmethyl]benzoic acid.
| Compound Name | 2-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfonylmethyl]benzoic acid |
|---|---|
| PubChem CID | 71714818 |
| Molecular Formula | C22H16ClNO7S2 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | 2-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfonylmethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CS(=O)(=O)c1ccc(Cl)cc1NS(=O)(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H16ClNO7S2/c23-16-9-10-20(32(27,28)13-15-6-1-3-7-17(15)22(25)26)18(12-16)24-33(29,30)21-11-14-5-2-4-8-19(14)31-21/h1-12,24H,13H2,(H,25,26) |
| InChIKey | CEWRLCDANYJASA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |