C22H16ClNO6S — CID 71726486
3-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenoxy]methyl]benzoic acid (PubChem CID 71726486) has the molecular formula C22H16ClNO6S and a molecular weight of 457.89 g/mol. Its IUPAC name is 3-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 71726486 |
| Molecular Formula | C22H16ClNO6S |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 3-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccc(Cl)cc2NS(=O)(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C22H16ClNO6S/c23-17-8-9-20(29-13-14-4-3-6-16(10-14)22(25)26)18(12-17)24-31(27,28)21-11-15-5-1-2-7-19(15)30-21/h1-12,24H,13H2,(H,25,26) |
| InChIKey | KWEPPSLXFACZDQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |