C22H19ClN2O6S — CID 177311375
4-[[2-[(4-acetamidophenyl)sulfonylamino]-4-chlorophenoxy]methyl]benzoic acid (PubChem CID 177311375) has the molecular formula C22H19ClN2O6S and a molecular weight of 474.92 g/mol. Its IUPAC name is 4-[[2-[(4-acetamidophenyl)sulfonylamino]-4-chlorophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(4-acetamidophenyl)sulfonylamino]-4-chlorophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 177311375 |
| Molecular Formula | C22H19ClN2O6S |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 4-[[2-[(4-acetamidophenyl)sulfonylamino]-4-chlorophenoxy]methyl]benzoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2cc(Cl)ccc2OCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H19ClN2O6S/c1-14(26)24-18-7-9-19(10-8-18)32(29,30)25-20-12-17(23)6-11-21(20)31-13-15-2-4-16(5-3-15)22(27)28/h2-12,25H,13H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | RSZMBAAMRNLJHG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |