C21H18ClNO5S — CID 22672083
4-[[2-(benzenesulfonamido)-4-chloro-5-methylphenoxy]methyl]benzoic acid (PubChem CID 22672083) has the molecular formula C21H18ClNO5S and a molecular weight of 431.90 g/mol. Its IUPAC name is 4-[[2-(benzenesulfonamido)-4-chloro-5-methylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-(benzenesulfonamido)-4-chloro-5-methylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 22672083 |
| Molecular Formula | C21H18ClNO5S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 4-[[2-(benzenesulfonamido)-4-chloro-5-methylphenoxy]methyl]benzoic acid |
| SMILES | Cc1cc(OCc2ccc(C(=O)O)cc2)c(NS(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H18ClNO5S/c1-14-11-20(28-13-15-7-9-16(10-8-15)21(24)25)19(12-18(14)22)23-29(26,27)17-5-3-2-4-6-17/h2-12,23H,13H2,1H3,(H,24,25) |
| InChIKey | ZWSORKSMVRYXTD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |