C21H19NO6S — CID 68688333
4-[2-[2-(benzenesulfonamido)phenoxy]ethoxy]benzoic acid (PubChem CID 68688333) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is 4-[2-[2-(benzenesulfonamido)phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[2-(benzenesulfonamido)phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 68688333 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 4-[2-[2-(benzenesulfonamido)phenoxy]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCOc2ccccc2NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO6S/c23-21(24)16-10-12-17(13-11-16)27-14-15-28-20-9-5-4-8-19(20)22-29(25,26)18-6-2-1-3-7-18/h1-13,22H,14-15H2,(H,23,24) |
| InChIKey | LFIXKTDPDNUFRN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|