C24H21NO5 — CID 68690016
4-[2-[2-(3-phenylprop-2-enoylamino)phenoxy]ethoxy]benzoic acid (PubChem CID 68690016) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is 4-[2-[2-(3-phenylprop-2-enoylamino)phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[2-(3-phenylprop-2-enoylamino)phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 68690016 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 4-[2-[2-(3-phenylprop-2-enoylamino)phenoxy]ethoxy]benzoic acid |
| SMILES | O=C(C=Cc1ccccc1)Nc1ccccc1OCCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H21NO5/c26-23(15-10-18-6-2-1-3-7-18)25-21-8-4-5-9-22(21)30-17-16-29-20-13-11-19(12-14-20)24(27)28/h1-15H,16-17H2,(H,25,26)(H,27,28) |
| InChIKey | SVRJVJFVXQWBBY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|