C22H17NO5 — CID 174534966
4-[2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]phenoxy]benzoic acid (PubChem CID 174534966) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is 4-[2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]phenoxy]benzoic acid.
| Compound Name | 4-[2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 174534966 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-[2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]phenoxy]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(O)cc1)Nc1ccccc1Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H17NO5/c24-17-10-5-15(6-11-17)7-14-21(25)23-19-3-1-2-4-20(19)28-18-12-8-16(9-13-18)22(26)27/h1-14,24H,(H,23,25)(H,26,27)/b14-7+ |
| InChIKey | YXCJGKKDCKOVAD-VGOFMYFVSA-N |
| XLogP | 4.53 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|