C23H21NO6 — CID 68690130
4-[2-[2-[(4-methoxybenzoyl)amino]phenoxy]ethoxy]benzoic acid (PubChem CID 68690130) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is 4-[2-[2-[(4-methoxybenzoyl)amino]phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[2-[(4-methoxybenzoyl)amino]phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 68690130 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-[2-[2-[(4-methoxybenzoyl)amino]phenoxy]ethoxy]benzoic acid |
| SMILES | COc1ccc(C(=O)Nc2ccccc2OCCOc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H21NO6/c1-28-18-10-6-16(7-11-18)22(25)24-20-4-2-3-5-21(20)30-15-14-29-19-12-8-17(9-13-19)23(26)27/h2-13H,14-15H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | YWRHAFSOAZRLAD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|