C44H40N2O10S — CID 161453027
4-[2-[2-[(4-ethylbenzoyl)amino]phenoxy]ethoxy]benzoic acid;4-[2-[2-(thiophene-2-carbonylamino)phenoxy]ethoxy]benzoic acid (PubChem CID 161453027) has the molecular formula C44H40N2O10S and a molecular weight of 788.88 g/mol. Its IUPAC name is 4-[2-[2-[(4-ethylbenzoyl)amino]phenoxy]ethoxy]benzoic acid;4-[2-[2-(thiophene-2-carbonylamino)phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[2-[(4-ethylbenzoyl)amino]phenoxy]ethoxy]benzoic acid;4-[2-[2-(thiophene-2-carbonylamino)phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 161453027 |
| Molecular Formula | C44H40N2O10S |
| Molecular Weight | 788.88 g/mol |
| Exact Mass | 788.24 |
| IUPAC Name | 4-[2-[2-[(4-ethylbenzoyl)amino]phenoxy]ethoxy]benzoic acid;4-[2-[2-(thiophene-2-carbonylamino)phenoxy]ethoxy]benzoic acid |
| SMILES | CCc1ccc(C(=O)Nc2ccccc2OCCOc2ccc(C(=O)O)cc2)cc1.O=C(O)c1ccc(OCCOc2ccccc2NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H23NO5.C20H17NO5S/c1-2-17-7-9-18(10-8-17)23(26)25-21-5-3-4-6-22(21)30-16-15-29-20-13-11-19(12-14-20)24(27)28;22-19(18-6-3-13-27-18)21-16-4-1-2-5-17(16)26-12-11-25-15-9-7-14(8-10-15)20(23)24/h3-14H,2,15-16H2,1H3,(H,25,26)(H,27,28);1-10,13H,11-12H2,(H,21,22)(H,23,24) |
| InChIKey | WATYQBAMZGUZCY-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.88 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|