C27H31NO3 — CID 7941963
4-[(4-tert-butylphenoxy)methyl]-N-(2-propoxyphenyl)benzamide (PubChem CID 7941963) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-[(4-tert-butylphenoxy)methyl]-N-(2-propoxyphenyl)benzamide.
| Compound Name | 4-[(4-tert-butylphenoxy)methyl]-N-(2-propoxyphenyl)benzamide |
|---|---|
| PubChem CID | 7941963 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 4-[(4-tert-butylphenoxy)methyl]-N-(2-propoxyphenyl)benzamide |
| SMILES | CCCOc1ccccc1NC(=O)c1ccc(COc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H31NO3/c1-5-18-30-25-9-7-6-8-24(25)28-26(29)21-12-10-20(11-13-21)19-31-23-16-14-22(15-17-23)27(2,3)4/h6-17H,5,18-19H2,1-4H3,(H,28,29) |
| InChIKey | FHFGUTKRDHTMMW-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |